C24H22N2O3 — CID 171987739
methyl 2-(3,5-diphenyl-5H-1,2,4-oxadiazol-4-yl)-3-phenylpropanoate (PubChem CID 171987739) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl 2-(3,5-diphenyl-5H-1,2,4-oxadiazol-4-yl)-3-phenylpropanoate.
| Compound Name | methyl 2-(3,5-diphenyl-5H-1,2,4-oxadiazol-4-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 171987739 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | methyl 2-(3,5-diphenyl-5H-1,2,4-oxadiazol-4-yl)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1C(c2ccccc2)=NOC1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O3/c1-28-24(27)21(17-18-11-5-2-6-12-18)26-22(19-13-7-3-8-14-19)25-29-23(26)20-15-9-4-10-16-20/h2-16,21,23H,17H2,1H3 |
| InChIKey | MSNBPZNAFHGONQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |