C14H14N6S — CID 171988727
4-anilino-3-(4,6-dimethylpyrimidin-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 171988727) has the molecular formula C14H14N6S and a molecular weight of 298.38 g/mol. Its IUPAC name is 4-anilino-3-(4,6-dimethylpyrimidin-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-anilino-3-(4,6-dimethylpyrimidin-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 171988727 |
| Molecular Formula | C14H14N6S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-anilino-3-(4,6-dimethylpyrimidin-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(C)nc(-c2n[nH]c(=S)n2Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H14N6S/c1-9-8-10(2)16-12(15-9)13-17-18-14(21)20(13)19-11-6-4-3-5-7-11/h3-8,19H,1-2H3,(H,18,21) |
| InChIKey | CCBBDOVBDDWYLL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|