About 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline
4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline (PubChem CID 171989287) has the molecular formula C25H30N4O4S
and a molecular weight of 482.61 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline.
Molecular Properties
| Compound Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline |
| PubChem CID | 171989287 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2nc(C3CCCC3)nc(N3CCN(S(=O)(=O)c4ccccc4)CC3)c2cc1OC |
| InChI | InChI=1S/C25H30N4O4S/c1-32-22-16-20-21(17-23(22)33-2)26-24(18-8-6-7-9-18)27-25(20)28-12-14-29(15-13-28)34(30,31)19-10-4-3-5-11-19/h3-5,10-11,16-18H,6-9,12-15H2,1-2H3 |
| InChIKey | NHLLAGDMPYSBGX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline?
The IUPAC name of 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline (CID 171989287) is 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline.
What is the SMILES notation for 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline?
The canonical SMILES for 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline is COc1cc2nc(C3CCCC3)nc(N3CCN(S(=O)(=O)c4ccccc4)CC3)c2cc1OC.
What is the InChIKey of 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline?
The InChIKey is NHLLAGDMPYSBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N4O4S/c1-32-22-16-20-21(17-23(22)33-2)26-24(18-8-6-7-9-18)27-25(20)28-12-14-29(15-13-28)34(30,31)19-10-4-3-5-11-19/h3-5,10-11,16-18H,6-9,12-15H2,1-2H3.
What are the key properties of 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline?
4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline has a molecular weight of 482.61 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyclopentyl-6,7-dimethoxyquinazoline is sourced from PubChem (CID 171989287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).