About methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate
methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate (PubChem CID 171989441) has the molecular formula C8H7NO2S2
and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate |
| PubChem CID | 171989441 |
| Molecular Formula | C8H7NO2S2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate |
| SMILES | COC(=O)c1csc2nc(C)sc12 |
| InChI | InChI=1S/C8H7NO2S2/c1-4-9-7-6(13-4)5(3-12-7)8(10)11-2/h3H,1-2H3 |
| InChIKey | GFQXCVRORZIGJF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate?
The IUPAC name of methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate (CID 171989441) is methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate.
What is the SMILES notation for methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate?
The canonical SMILES for methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate is COC(=O)c1csc2nc(C)sc12.
What is the InChIKey of methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate?
The InChIKey is GFQXCVRORZIGJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S2/c1-4-9-7-6(13-4)5(3-12-7)8(10)11-2/h3H,1-2H3.
What are the key properties of methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate?
methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylthieno[2,3-d][1,3]thiazole-6-carboxylate is sourced from PubChem (CID 171989441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).