C11H11NO6 — CID 171989585
1-hydroxy-7-(hydroxymethyl)-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione (PubChem CID 171989585) has the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. Its IUPAC name is 1-hydroxy-7-(hydroxymethyl)-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione.
| Compound Name | 1-hydroxy-7-(hydroxymethyl)-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
|---|---|
| PubChem CID | 171989585 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 1-hydroxy-7-(hydroxymethyl)-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
| SMILES | CN1C(=O)C2C(C1=O)C1(O)C=CC2(CO)OC1=O |
| InChI | InChI=1S/C11H11NO6/c1-12-7(14)5-6(8(12)15)11(17)3-2-10(5,4-13)18-9(11)16/h2-3,5-6,13,17H,4H2,1H3 |
| InChIKey | RYPVIJZLLOOPRS-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|