About [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate
[3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate (PubChem CID 171990092) has the molecular formula C24H23F2NO3
and a molecular weight of 411.45 g/mol. Its IUPAC name is [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate.
Molecular Properties
| Compound Name | [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate |
| PubChem CID | 171990092 |
| Molecular Formula | C24H23F2NO3 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate |
| SMILES | CCN(Cc1ccc2cc(F)c(F)cc2c1)C(=O)C(COC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C24H23F2NO3/c1-3-27(14-17-9-10-19-12-22(25)23(26)13-20(19)11-17)24(29)21(15-30-16(2)28)18-7-5-4-6-8-18/h4-13,21H,3,14-15H2,1-2H3 |
| InChIKey | OGJVSJGSNMWKKJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate?
The IUPAC name of [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate (CID 171990092) is [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate.
What is the SMILES notation for [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate?
The canonical SMILES for [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate is CCN(Cc1ccc2cc(F)c(F)cc2c1)C(=O)C(COC(C)=O)c1ccccc1.
What is the InChIKey of [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate?
The InChIKey is OGJVSJGSNMWKKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F2NO3/c1-3-27(14-17-9-10-19-12-22(25)23(26)13-20(19)11-17)24(29)21(15-30-16(2)28)18-7-5-4-6-8-18/h4-13,21H,3,14-15H2,1-2H3.
What are the key properties of [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate?
[3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate has a molecular weight of 411.45 g/mol, XLogP of 4.81, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(6,7-difluoronaphthalen-2-yl)methyl-ethylamino]-3-oxo-2-phenylpropyl] acetate is sourced from PubChem (CID 171990092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).