C28H34N6O3S — CID 171990771
9-ethoxy-10-methoxy-3-[2-(1,3,4-thiadiazol-2-ylamino)ethyl]-2-(2,4,6-trimethylphenyl)imino-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 171990771) has the molecular formula C28H34N6O3S and a molecular weight of 534.69 g/mol. Its IUPAC name is 9-ethoxy-10-methoxy-3-[2-(1,3,4-thiadiazol-2-ylamino)ethyl]-2-(2,4,6-trimethylphenyl)imino-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 9-ethoxy-10-methoxy-3-[2-(1,3,4-thiadiazol-2-ylamino)ethyl]-2-(2,4,6-trimethylphenyl)imino-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 171990771 |
| Molecular Formula | C28H34N6O3S |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 9-ethoxy-10-methoxy-3-[2-(1,3,4-thiadiazol-2-ylamino)ethyl]-2-(2,4,6-trimethylphenyl)imino-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | CCOc1cc2c(cc1OC)C1C/C(=N\c3c(C)cc(C)cc3C)N(CCNc3nncs3)C(=O)N1CC2 |
| InChI | InChI=1S/C28H34N6O3S/c1-6-37-24-13-20-7-9-33-22(21(20)14-23(24)36-5)15-25(31-26-18(3)11-17(2)12-19(26)4)34(28(33)35)10-8-29-27-32-30-16-38-27/h11-14,16,22H,6-10,15H2,1-5H3,(H,29,32)/b31-25+ |
| InChIKey | ROUWHHXAXOSZKM-QCKNELIISA-N |
| XLogP | 5.44 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|