C34H33F3N6O — CID 171990949
4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-amine (PubChem CID 171990949) has the molecular formula C34H33F3N6O and a molecular weight of 598.67 g/mol. Its IUPAC name is 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-amine.
| Compound Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-amine |
|---|---|
| PubChem CID | 171990949 |
| Molecular Formula | C34H33F3N6O |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-amine |
| SMILES | C#Cc1c(F)ccc2cc(N)cc(-c3ccc4c(N5CC6CCC(C5)N6)nc(OCC56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C34H33F3N6O/c1-2-24-28(36)9-4-19-12-21(38)13-27(29(19)24)25-7-8-26-31(30(25)37)40-33(41-32(26)42-16-22-5-6-23(17-42)39-22)44-18-34-10-3-11-43(34)15-20(35)14-34/h1,4,7-9,12-13,20,22-23,39H,3,5-6,10-11,14-18,38H2/t20-,22?,23?,34?/m1/s1 |
| InChIKey | XPWIJJQRVMTQMZ-BUHHSSQWSA-N |
| XLogP | 5.19 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|