C22H25N5O2S — CID 171991957
(1S,2S,8R,9R)-8-(2,5-dihydropyrrole-1-carbonyl)-11-thieno[3,2-d]pyrimidin-4-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 171991957) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is (1S,2S,8R,9R)-8-(2,5-dihydropyrrole-1-carbonyl)-11-thieno[3,2-d]pyrimidin-4-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1S,2S,8R,9R)-8-(2,5-dihydropyrrole-1-carbonyl)-11-thieno[3,2-d]pyrimidin-4-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 171991957 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (1S,2S,8R,9R)-8-(2,5-dihydropyrrole-1-carbonyl)-11-thieno[3,2-d]pyrimidin-4-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C([C@H]1[C@@H]2C[C@@H](CN(c3ncnc4ccsc34)C2)[C@@H]2CCCC(=O)N21)N1CC=CC1 |
| InChI | InChI=1S/C22H25N5O2S/c28-18-5-3-4-17-14-10-15(19(27(17)18)22(29)25-7-1-2-8-25)12-26(11-14)21-20-16(6-9-30-20)23-13-24-21/h1-2,6,9,13-15,17,19H,3-5,7-8,10-12H2/t14-,15+,17-,19+/m0/s1 |
| InChIKey | MPGXZVMWFPGDSR-JHDROBOHSA-N |
| XLogP | 2.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|