C24H25N3O4 — CID 171991958
formic acid;1-[2-[2-(2-imidazol-1-ylethoxy)phenyl]-4-methylquinolin-7-yl]ethanol (PubChem CID 171991958) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is formic acid;1-[2-[2-(2-imidazol-1-ylethoxy)phenyl]-4-methylquinolin-7-yl]ethanol.
| Compound Name | formic acid;1-[2-[2-(2-imidazol-1-ylethoxy)phenyl]-4-methylquinolin-7-yl]ethanol |
|---|---|
| PubChem CID | 171991958 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | formic acid;1-[2-[2-(2-imidazol-1-ylethoxy)phenyl]-4-methylquinolin-7-yl]ethanol |
| SMILES | Cc1cc(-c2ccccc2OCCn2ccnc2)nc2cc(C(C)O)ccc12.O=CO |
| InChI | InChI=1S/C23H23N3O2.CH2O2/c1-16-13-21(25-22-14-18(17(2)27)7-8-19(16)22)20-5-3-4-6-23(20)28-12-11-26-10-9-24-15-26;2-1-3/h3-10,13-15,17,27H,11-12H2,1-2H3;1H,(H,2,3) |
| InChIKey | SSNNJJYAYMYJSP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|