C21H29NO5 — CID 171992261
1-(3,4-dimethoxyphenyl)-N-[2-(2-methoxyphenyl)ethyl]propan-2-amine;formic acid (PubChem CID 171992261) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-[2-(2-methoxyphenyl)ethyl]propan-2-amine;formic acid.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-[2-(2-methoxyphenyl)ethyl]propan-2-amine;formic acid |
|---|---|
| PubChem CID | 171992261 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-[2-(2-methoxyphenyl)ethyl]propan-2-amine;formic acid |
| SMILES | COc1ccccc1CCNC(C)Cc1ccc(OC)c(OC)c1.O=CO |
| InChI | InChI=1S/C20H27NO3.CH2O2/c1-15(13-16-9-10-19(23-3)20(14-16)24-4)21-12-11-17-7-5-6-8-18(17)22-2;2-1-3/h5-10,14-15,21H,11-13H2,1-4H3;1H,(H,2,3) |
| InChIKey | BEUKGVXMWLRPHI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|