C17H34NP — CID 171992343
1-di(propan-2-yl)phosphanyl-N,N-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-amine (PubChem CID 171992343) has the molecular formula C17H34NP and a molecular weight of 283.44 g/mol. Its IUPAC name is 1-di(propan-2-yl)phosphanyl-N,N-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-amine.
| Compound Name | 1-di(propan-2-yl)phosphanyl-N,N-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 171992343 |
| Molecular Formula | C17H34NP |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | 1-di(propan-2-yl)phosphanyl-N,N-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-amine |
| SMILES | CC(C)P(C(C)C)C1C2CCCCC2CC1N(C)C |
| InChI | InChI=1S/C17H34NP/c1-12(2)19(13(3)4)17-15-10-8-7-9-14(15)11-16(17)18(5)6/h12-17H,7-11H2,1-6H3 |
| InChIKey | KFVJCGIVCOXKFR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|