About 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide
1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide (PubChem CID 171992627) has the molecular formula C19H26N4O2
and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide |
| PubChem CID | 171992627 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(C#N)c(N2CCC(C(=O)NC3CCOCC3)CC2)n1 |
| InChI | InChI=1S/C19H26N4O2/c1-13-11-14(2)21-18(17(13)12-20)23-7-3-15(4-8-23)19(24)22-16-5-9-25-10-6-16/h11,15-16H,3-10H2,1-2H3,(H,22,24) |
| InChIKey | PKXUWFIAXJPEQH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide?
The IUPAC name of 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide (CID 171992627) is 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide.
What is the SMILES notation for 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide?
The canonical SMILES for 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide is Cc1cc(C)c(C#N)c(N2CCC(C(=O)NC3CCOCC3)CC2)n1.
What is the InChIKey of 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide?
The InChIKey is PKXUWFIAXJPEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O2/c1-13-11-14(2)21-18(17(13)12-20)23-7-3-15(4-8-23)19(24)22-16-5-9-25-10-6-16/h11,15-16H,3-10H2,1-2H3,(H,22,24).
What are the key properties of 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide?
1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide has a molecular weight of 342.44 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-(oxan-4-yl)piperidine-4-carboxamide is sourced from PubChem (CID 171992627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).