About 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone
1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone (PubChem CID 171992794) has the molecular formula C17H22F3N3O
and a molecular weight of 341.38 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone |
| PubChem CID | 171992794 |
| Molecular Formula | C17H22F3N3O |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone |
| SMILES | O=C(CC1CCN(c2ncccc2F)CC1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H22F3N3O/c18-14-2-1-7-21-16(14)23-8-3-13(4-9-23)12-15(24)22-10-5-17(19,20)6-11-22/h1-2,7,13H,3-6,8-12H2 |
| InChIKey | XVNZEFIJFGGKEO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone?
The IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone (CID 171992794) is 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone.
What is the SMILES notation for 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone?
The canonical SMILES for 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone is O=C(CC1CCN(c2ncccc2F)CC1)N1CCC(F)(F)CC1.
What is the InChIKey of 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone?
The InChIKey is XVNZEFIJFGGKEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F3N3O/c18-14-2-1-7-21-16(14)23-8-3-13(4-9-23)12-15(24)22-10-5-17(19,20)6-11-22/h1-2,7,13H,3-6,8-12H2.
What are the key properties of 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone?
1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone has a molecular weight of 341.38 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluoropiperidin-1-yl)-2-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]ethanone is sourced from PubChem (CID 171992794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).