About 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone
1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone (PubChem CID 171993027) has the molecular formula C17H24F2N4O2
and a molecular weight of 354.40 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone |
| PubChem CID | 171993027 |
| Molecular Formula | C17H24F2N4O2 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone |
| SMILES | COc1cc(N2CCC(CC(=O)N3CCC(F)(F)CC3)CC2)ncn1 |
| InChI | InChI=1S/C17H24F2N4O2/c1-25-15-11-14(20-12-21-15)22-6-2-13(3-7-22)10-16(24)23-8-4-17(18,19)5-9-23/h11-13H,2-10H2,1H3 |
| InChIKey | GUPSPBJWPHKZDE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone?
The IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone (CID 171993027) is 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone.
What is the SMILES notation for 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone?
The canonical SMILES for 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone is COc1cc(N2CCC(CC(=O)N3CCC(F)(F)CC3)CC2)ncn1.
What is the InChIKey of 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone?
The InChIKey is GUPSPBJWPHKZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F2N4O2/c1-25-15-11-14(20-12-21-15)22-6-2-13(3-7-22)10-16(24)23-8-4-17(18,19)5-9-23/h11-13H,2-10H2,1H3.
What are the key properties of 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone?
1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone has a molecular weight of 354.40 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluoropiperidin-1-yl)-2-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]ethanone is sourced from PubChem (CID 171993027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).