C17H27N5O2 — CID 171993861
1-methyl-N-[1-(2-oxo-2-piperidin-1-ylethyl)piperidin-3-yl]pyrazole-3-carboxamide (PubChem CID 171993861) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-methyl-N-[1-(2-oxo-2-piperidin-1-ylethyl)piperidin-3-yl]pyrazole-3-carboxamide.
| Compound Name | 1-methyl-N-[1-(2-oxo-2-piperidin-1-ylethyl)piperidin-3-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 171993861 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 1-methyl-N-[1-(2-oxo-2-piperidin-1-ylethyl)piperidin-3-yl]pyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)NC2CCCN(CC(=O)N3CCCCC3)C2)n1 |
| InChI | InChI=1S/C17H27N5O2/c1-20-11-7-15(19-20)17(24)18-14-6-5-8-21(12-14)13-16(23)22-9-3-2-4-10-22/h7,11,14H,2-6,8-10,12-13H2,1H3,(H,18,24) |
| InChIKey | UWXRIPBUWIDPAY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |