C14H21N7O — CID 171994150
1-methyl-N-[1-[2-(triazol-2-yl)ethyl]piperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 171994150) has the molecular formula C14H21N7O and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-methyl-N-[1-[2-(triazol-2-yl)ethyl]piperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[1-[2-(triazol-2-yl)ethyl]piperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171994150 |
| Molecular Formula | C14H21N7O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-methyl-N-[1-[2-(triazol-2-yl)ethyl]piperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC2CCCN(CCn3nccn3)C2)cn1 |
| InChI | InChI=1S/C14H21N7O/c1-19-10-12(9-17-19)14(22)18-13-3-2-6-20(11-13)7-8-21-15-4-5-16-21/h4-5,9-10,13H,2-3,6-8,11H2,1H3,(H,18,22) |
| InChIKey | RJTCKWNYHBJLCS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |