C15H17N7O — CID 171994191
N-[1-(4-cyanopyrimidin-2-yl)piperidin-4-yl]-1-methylpyrazole-3-carboxamide (PubChem CID 171994191) has the molecular formula C15H17N7O and a molecular weight of 311.35 g/mol. Its IUPAC name is N-[1-(4-cyanopyrimidin-2-yl)piperidin-4-yl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[1-(4-cyanopyrimidin-2-yl)piperidin-4-yl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 171994191 |
| Molecular Formula | C15H17N7O |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-[1-(4-cyanopyrimidin-2-yl)piperidin-4-yl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)NC2CCN(c3nccc(C#N)n3)CC2)n1 |
| InChI | InChI=1S/C15H17N7O/c1-21-7-5-13(20-21)14(23)18-11-3-8-22(9-4-11)15-17-6-2-12(10-16)19-15/h2,5-7,11H,3-4,8-9H2,1H3,(H,18,23) |
| InChIKey | DALXYUXPQPQKOC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |