C20H27N3O3S — CID 171995182
1-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(oxan-4-yl)piperidine-4-carboxamide (PubChem CID 171995182) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(oxan-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(oxan-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 171995182 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(oxan-4-yl)piperidine-4-carboxamide |
| SMILES | CCOc1ccc2nc(N3CCC(C(=O)NC4CCOCC4)CC3)sc2c1 |
| InChI | InChI=1S/C20H27N3O3S/c1-2-26-16-3-4-17-18(13-16)27-20(22-17)23-9-5-14(6-10-23)19(24)21-15-7-11-25-12-8-15/h3-4,13-15H,2,5-12H2,1H3,(H,21,24) |
| InChIKey | UKDBLZQDBUKYNX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |