C14H18N6 — CID 171996018
6-methyl-N-[1-(pyrazin-2-ylmethyl)pyrrolidin-3-yl]pyrimidin-4-amine (PubChem CID 171996018) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is 6-methyl-N-[1-(pyrazin-2-ylmethyl)pyrrolidin-3-yl]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-[1-(pyrazin-2-ylmethyl)pyrrolidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 171996018 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 6-methyl-N-[1-(pyrazin-2-ylmethyl)pyrrolidin-3-yl]pyrimidin-4-amine |
| SMILES | Cc1cc(NC2CCN(Cc3cnccn3)C2)ncn1 |
| InChI | InChI=1S/C14H18N6/c1-11-6-14(18-10-17-11)19-12-2-5-20(8-12)9-13-7-15-3-4-16-13/h3-4,6-7,10,12H,2,5,8-9H2,1H3,(H,17,18,19) |
| InChIKey | RXBPGJZZCOWGHS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |