About N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine
N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine (PubChem CID 171996610) has the molecular formula C10H9FN2O
and a molecular weight of 192.19 g/mol. Its IUPAC name is N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine |
| PubChem CID | 171996610 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine |
| SMILES | Fc1ccc2nc(NC3CC3)oc2c1 |
| InChI | InChI=1S/C10H9FN2O/c11-6-1-4-8-9(5-6)14-10(13-8)12-7-2-3-7/h1,4-5,7H,2-3H2,(H,12,13) |
| InChIKey | AGGNUOQFOLQVKP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine?
The IUPAC name of N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine (CID 171996610) is N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine.
What is the SMILES notation for N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine?
The canonical SMILES for N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine is Fc1ccc2nc(NC3CC3)oc2c1.
What is the InChIKey of N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine?
The InChIKey is AGGNUOQFOLQVKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O/c11-6-1-4-8-9(5-6)14-10(13-8)12-7-2-3-7/h1,4-5,7H,2-3H2,(H,12,13).
What are the key properties of N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine?
N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine has a molecular weight of 192.19 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-6-fluoro-1,3-benzoxazol-2-amine is sourced from PubChem (CID 171996610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).