C13H13FN2O2 — CID 171996999
6-fluoro-N,N,2-trimethyl-1-oxoisoquinoline-3-carboxamide (PubChem CID 171996999) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is 6-fluoro-N,N,2-trimethyl-1-oxoisoquinoline-3-carboxamide.
| Compound Name | 6-fluoro-N,N,2-trimethyl-1-oxoisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 171996999 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 6-fluoro-N,N,2-trimethyl-1-oxoisoquinoline-3-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cc(F)ccc2c(=O)n1C |
| InChI | InChI=1S/C13H13FN2O2/c1-15(2)13(18)11-7-8-6-9(14)4-5-10(8)12(17)16(11)3/h4-7H,1-3H3 |
| InChIKey | ZIOBYDZKYJAAFO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |