About 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide
4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide (PubChem CID 171998071) has the molecular formula C17H20N6O2S
and a molecular weight of 372.45 g/mol. Its IUPAC name is 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide |
| PubChem CID | 171998071 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide |
| SMILES | Cn1ccc2c(N3CCN(c4ccc(S(N)(=O)=O)cc4)CC3)ncnc21 |
| InChI | InChI=1S/C17H20N6O2S/c1-21-7-6-15-16(21)19-12-20-17(15)23-10-8-22(9-11-23)13-2-4-14(5-3-13)26(18,24)25/h2-7,12H,8-11H2,1H3,(H2,18,24,25) |
| InChIKey | XWADRNWYOQVOLK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide?
The IUPAC name of 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide (CID 171998071) is 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide.
What is the SMILES notation for 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide?
The canonical SMILES for 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide is Cn1ccc2c(N3CCN(c4ccc(S(N)(=O)=O)cc4)CC3)ncnc21.
What is the InChIKey of 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide?
The InChIKey is XWADRNWYOQVOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N6O2S/c1-21-7-6-15-16(21)19-12-20-17(15)23-10-8-22(9-11-23)13-2-4-14(5-3-13)26(18,24)25/h2-7,12H,8-11H2,1H3,(H2,18,24,25).
What are the key properties of 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide?
4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide has a molecular weight of 372.45 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]benzenesulfonamide is sourced from PubChem (CID 171998071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).