C16H16BrF3N4 — CID 171998614
N-[1-[(3-bromophenyl)methyl]pyrrolidin-3-yl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 171998614) has the molecular formula C16H16BrF3N4 and a molecular weight of 401.23 g/mol. Its IUPAC name is N-[1-[(3-bromophenyl)methyl]pyrrolidin-3-yl]-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[1-[(3-bromophenyl)methyl]pyrrolidin-3-yl]-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 171998614 |
| Molecular Formula | C16H16BrF3N4 |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | N-[1-[(3-bromophenyl)methyl]pyrrolidin-3-yl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc(NC2CCN(Cc3cccc(Br)c3)C2)ncn1 |
| InChI | InChI=1S/C16H16BrF3N4/c17-12-3-1-2-11(6-12)8-24-5-4-13(9-24)23-15-7-14(16(18,19)20)21-10-22-15/h1-3,6-7,10,13H,4-5,8-9H2,(H,21,22,23) |
| InChIKey | WBIXEENOJZFJHC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |