C18H19N7O — CID 171998721
3-[[4-(9-methylpurin-6-yl)piperazin-1-yl]methyl]-1,2-benzoxazole (PubChem CID 171998721) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is 3-[[4-(9-methylpurin-6-yl)piperazin-1-yl]methyl]-1,2-benzoxazole.
| Compound Name | 3-[[4-(9-methylpurin-6-yl)piperazin-1-yl]methyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 171998721 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-[[4-(9-methylpurin-6-yl)piperazin-1-yl]methyl]-1,2-benzoxazole |
| SMILES | Cn1cnc2c(N3CCN(Cc4noc5ccccc45)CC3)ncnc21 |
| InChI | InChI=1S/C18H19N7O/c1-23-12-21-16-17(23)19-11-20-18(16)25-8-6-24(7-9-25)10-14-13-4-2-3-5-15(13)26-22-14/h2-5,11-12H,6-10H2,1H3 |
| InChIKey | OUIYEERVXGDRGW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |