C17H20F2N2O2 — CID 171999515
2-butyl-6,7-difluoro-1-oxo-N-propylisoquinoline-3-carboxamide (PubChem CID 171999515) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-butyl-6,7-difluoro-1-oxo-N-propylisoquinoline-3-carboxamide.
| Compound Name | 2-butyl-6,7-difluoro-1-oxo-N-propylisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 171999515 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-butyl-6,7-difluoro-1-oxo-N-propylisoquinoline-3-carboxamide |
| SMILES | CCCCn1c(C(=O)NCCC)cc2cc(F)c(F)cc2c1=O |
| InChI | InChI=1S/C17H20F2N2O2/c1-3-5-7-21-15(16(22)20-6-4-2)9-11-8-13(18)14(19)10-12(11)17(21)23/h8-10H,3-7H2,1-2H3,(H,20,22) |
| InChIKey | LFIAQBWOKHKFIM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |