C15H18FN5O — CID 171999804
2-cyclopropyl-5-[[4-(2-fluoro-4-pyridinyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole (PubChem CID 171999804) has the molecular formula C15H18FN5O and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-cyclopropyl-5-[[4-(2-fluoro-4-pyridinyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-cyclopropyl-5-[[4-(2-fluoro-4-pyridinyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 171999804 |
| Molecular Formula | C15H18FN5O |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-cyclopropyl-5-[[4-(2-fluoro-4-pyridinyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole |
| SMILES | Fc1cc(N2CCN(Cc3nnc(C4CC4)o3)CC2)ccn1 |
| InChI | InChI=1S/C15H18FN5O/c16-13-9-12(3-4-17-13)21-7-5-20(6-8-21)10-14-18-19-15(22-14)11-1-2-11/h3-4,9,11H,1-2,5-8,10H2 |
| InChIKey | KTZJPAONFQSBKK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|