C19H22N2O5S — CID 17200397
N-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzamide (PubChem CID 17200397) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is N-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzamide.
| Compound Name | N-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 17200397 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzamide |
| SMILES | CC(C)(C)NC(=O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H22N2O5S/c1-19(2,3)20-18(22)14-6-4-5-7-15(14)21-27(23,24)13-8-9-16-17(12-13)26-11-10-25-16/h4-9,12,21H,10-11H2,1-3H3,(H,20,22) |
| InChIKey | VAXQFZQBVYUERE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |