C30H40N4O4 — CID 17201637
1-N,4-N-bis[4-(butan-2-ylcarbamoyl)phenyl]cyclohexane-1,4-dicarboxamide (PubChem CID 17201637) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(butan-2-ylcarbamoyl)phenyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-(butan-2-ylcarbamoyl)phenyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 17201637 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 1-N,4-N-bis[4-(butan-2-ylcarbamoyl)phenyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1ccc(NC(=O)C2CCC(C(=O)Nc3ccc(C(=O)NC(C)CC)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H40N4O4/c1-5-19(3)31-27(35)23-11-15-25(16-12-23)33-29(37)21-7-9-22(10-8-21)30(38)34-26-17-13-24(14-18-26)28(36)32-20(4)6-2/h11-22H,5-10H2,1-4H3,(H,31,35)(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | IVQLGRLBURQTOV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |