C21H18ClN5O4S — CID 17202955
N-[5-[1-(3-chloro-4-methylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide (PubChem CID 17202955) has the molecular formula C21H18ClN5O4S and a molecular weight of 471.93 g/mol. Its IUPAC name is N-[5-[1-(3-chloro-4-methylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[5-[1-(3-chloro-4-methylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17202955 |
| Molecular Formula | C21H18ClN5O4S |
| Molecular Weight | 471.93 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-[5-[1-(3-chloro-4-methylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(N2CC(c3nnc(NC(=O)c4ccc(C)c([N+](=O)[O-])c4)s3)CC2=O)cc1Cl |
| InChI | InChI=1S/C21H18ClN5O4S/c1-11-4-6-15(9-16(11)22)26-10-14(8-18(26)28)20-24-25-21(32-20)23-19(29)13-5-3-12(2)17(7-13)27(30)31/h3-7,9,14H,8,10H2,1-2H3,(H,23,25,29) |
| InChIKey | OMOAFQJYNFYLCY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.93 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|