C26H21N5O3S — CID 17203887
3-benzamido-N-[5-(5-oxo-1-phenylpyrrolidin-3-yl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 17203887) has the molecular formula C26H21N5O3S and a molecular weight of 483.55 g/mol. Its IUPAC name is 3-benzamido-N-[5-(5-oxo-1-phenylpyrrolidin-3-yl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-benzamido-N-[5-(5-oxo-1-phenylpyrrolidin-3-yl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 17203887 |
| Molecular Formula | C26H21N5O3S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 3-benzamido-N-[5-(5-oxo-1-phenylpyrrolidin-3-yl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2nnc(C3CC(=O)N(c4ccccc4)C3)s2)c1)c1ccccc1 |
| InChI | InChI=1S/C26H21N5O3S/c32-22-15-19(16-31(22)21-12-5-2-6-13-21)25-29-30-26(35-25)28-24(34)18-10-7-11-20(14-18)27-23(33)17-8-3-1-4-9-17/h1-14,19H,15-16H2,(H,27,33)(H,28,30,34) |
| InChIKey | CJDZTBNWXPGTIU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |