C15H26ClNO2 — CID 17206683
N-[(2-ethoxy-3-methoxyphenyl)methyl]-3-methylbutan-1-amine;hydrochloride (PubChem CID 17206683) has the molecular formula C15H26ClNO2 and a molecular weight of 287.83 g/mol. Its IUPAC name is N-[(2-ethoxy-3-methoxyphenyl)methyl]-3-methylbutan-1-amine;hydrochloride.
| Compound Name | N-[(2-ethoxy-3-methoxyphenyl)methyl]-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17206683 |
| Molecular Formula | C15H26ClNO2 |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[(2-ethoxy-3-methoxyphenyl)methyl]-3-methylbutan-1-amine;hydrochloride |
| SMILES | CCOc1c(CNCCC(C)C)cccc1OC.Cl |
| InChI | InChI=1S/C15H25NO2.ClH/c1-5-18-15-13(7-6-8-14(15)17-4)11-16-10-9-12(2)3;/h6-8,12,16H,5,9-11H2,1-4H3;1H |
| InChIKey | RVNXZFMLPRRAGC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|