About Benzyltriethylammonium
Benzyltriethylammonium (PubChem CID 17208) has the molecular formula C13H22N+
and a molecular weight of 192.32 g/mol. Its IUPAC name is benzyl(triethyl)azanium.
Molecular Properties
| Compound Name | Benzyltriethylammonium |
| PubChem CID | 17208 |
| Molecular Formula | C13H22N+ |
| Molecular Weight | 192.32 g/mol |
| Exact Mass | 192.18 |
| IUPAC Name | benzyl(triethyl)azanium |
| SMILES | CC[N+](CC)(CC)CC1=CC=CC=C1 |
| InChI | InChI=1S/C13H22N/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13/h7-11H,4-6,12H2,1-3H3/q+1 |
| InChIKey | VBQDSLGFSUGBBE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | 135 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze Benzyltriethylammonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzyltriethylammonium?
The IUPAC name of Benzyltriethylammonium (CID 17208) is benzyl(triethyl)azanium.
What is the SMILES notation for Benzyltriethylammonium?
The canonical SMILES for Benzyltriethylammonium is CC[N+](CC)(CC)CC1=CC=CC=C1.
What is the InChIKey of Benzyltriethylammonium?
The InChIKey is VBQDSLGFSUGBBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13/h7-11H,4-6,12H2,1-3H3/q+1.
What are the key properties of Benzyltriethylammonium?
Benzyltriethylammonium has a molecular weight of 192.32 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Benzyltriethylammonium is sourced from PubChem (CID 17208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).