About Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate
Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate (PubChem CID 172094476) has the molecular formula C18H24N2O4
and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate.
Molecular Properties
| Compound Name | Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate |
| PubChem CID | 172094476 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate |
| SMILES | CC1=C(C=CC=C1N2CCC(=O)NC2=O)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24N2O4/c1-12-13(8-9-16(22)24-18(2,3)4)6-5-7-14(12)20-11-10-15(21)19-17(20)23/h5-7H,8-11H2,1-4H3,(H,19,21,23) |
| InChIKey | LBTGHRLXHOBSOO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | 498 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate?
The IUPAC name of Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate (CID 172094476) is tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate.
What is the SMILES notation for Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate?
The canonical SMILES for Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate is CC1=C(C=CC=C1N2CCC(=O)NC2=O)CCC(=O)OC(C)(C)C.
What is the InChIKey of Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate?
The InChIKey is LBTGHRLXHOBSOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4/c1-12-13(8-9-16(22)24-18(2,3)4)6-5-7-14(12)20-11-10-15(21)19-17(20)23/h5-7H,8-11H2,1-4H3,(H,19,21,23).
What are the key properties of Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate?
Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate has a molecular weight of 332.40 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Tert-butyl 3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanoate is sourced from PubChem (CID 172094476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).