C19H23Cl2NO — CID 17210867
N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-methylbutan-2-amine (PubChem CID 17210867) has the molecular formula C19H23Cl2NO and a molecular weight of 352.31 g/mol. Its IUPAC name is N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-methylbutan-2-amine.
| Compound Name | N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 17210867 |
| Molecular Formula | C19H23Cl2NO |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-methylbutan-2-amine |
| SMILES | CCC(C)(C)NCc1cc(Cl)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23Cl2NO/c1-4-19(2,3)22-12-15-11-17(21)9-10-18(15)23-13-14-5-7-16(20)8-6-14/h5-11,22H,4,12-13H2,1-3H3 |
| InChIKey | AOJVZRPUXWAHGR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |