C17H21Cl2N — CID 17211329
N-[(2-chlorophenyl)methyl]-4-phenylbutan-2-amine;hydrochloride (PubChem CID 17211329) has the molecular formula C17H21Cl2N and a molecular weight of 310.27 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-phenylbutan-2-amine;hydrochloride.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-phenylbutan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17211329 |
| Molecular Formula | C17H21Cl2N |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-phenylbutan-2-amine;hydrochloride |
| SMILES | CC(CCc1ccccc1)NCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C17H20ClN.ClH/c1-14(11-12-15-7-3-2-4-8-15)19-13-16-9-5-6-10-17(16)18;/h2-10,14,19H,11-13H2,1H3;1H |
| InChIKey | RMKPXDNIPVLFHX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |