C18H30Cl2N2O2 — CID 17213871
1-(1-ethylpyrrolidin-2-yl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]methanamine;dihydrochloride (PubChem CID 17213871) has the molecular formula C18H30Cl2N2O2 and a molecular weight of 377.36 g/mol. Its IUPAC name is 1-(1-ethylpyrrolidin-2-yl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]methanamine;dihydrochloride.
| Compound Name | 1-(1-ethylpyrrolidin-2-yl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 17213871 |
| Molecular Formula | C18H30Cl2N2O2 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-(1-ethylpyrrolidin-2-yl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]methanamine;dihydrochloride |
| SMILES | C=CCOc1ccc(CNCC2CCCN2CC)cc1OC.Cl.Cl |
| InChI | InChI=1S/C18H28N2O2.2ClH/c1-4-11-22-17-9-8-15(12-18(17)21-3)13-19-14-16-7-6-10-20(16)5-2;;/h4,8-9,12,16,19H,1,5-7,10-11,13-14H2,2-3H3;2*1H |
| InChIKey | CQYISRFPNVULMI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|