About trimethoxysilane
trimethoxysilane (PubChem CID 17215) has the molecular formula C3H10O3Si
and a molecular weight of 122.20 g/mol. Its IUPAC name is trimethoxysilane.
Molecular Properties
| Compound Name | trimethoxysilane |
| PubChem CID | 17215 |
| Molecular Formula | C3H10O3Si |
| Molecular Weight | 122.20 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | trimethoxysilane |
| SMILES | CO[SiH](OC)OC |
| InChI | InChI=1S/C3H10O3Si/c1-4-7(5-2)6-3/h7H,1-3H3 |
| InChIKey | YUYCVXFAYWRXLS-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.20 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxysilane?
The IUPAC name of trimethoxysilane (CID 17215) is trimethoxysilane.
What is the SMILES notation for trimethoxysilane?
The canonical SMILES for trimethoxysilane is CO[SiH](OC)OC.
What is the InChIKey of trimethoxysilane?
The InChIKey is YUYCVXFAYWRXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3Si/c1-4-7(5-2)6-3/h7H,1-3H3.
What are the key properties of trimethoxysilane?
trimethoxysilane has a molecular weight of 122.20 g/mol, XLogP of -0.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxysilane is sourced from PubChem (CID 17215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).