C22H41Cl2N3O3 — CID 17215098
N-tert-butyl-2-[4-[[3-(diethylamino)propylamino]methyl]-2-ethoxyphenoxy]acetamide;dihydrochloride (PubChem CID 17215098) has the molecular formula C22H41Cl2N3O3 and a molecular weight of 466.49 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[3-(diethylamino)propylamino]methyl]-2-ethoxyphenoxy]acetamide;dihydrochloride.
| Compound Name | N-tert-butyl-2-[4-[[3-(diethylamino)propylamino]methyl]-2-ethoxyphenoxy]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 17215098 |
| Molecular Formula | C22H41Cl2N3O3 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | N-tert-butyl-2-[4-[[3-(diethylamino)propylamino]methyl]-2-ethoxyphenoxy]acetamide;dihydrochloride |
| SMILES | CCOc1cc(CNCCCN(CC)CC)ccc1OCC(=O)NC(C)(C)C.Cl.Cl |
| InChI | InChI=1S/C22H39N3O3.2ClH/c1-7-25(8-2)14-10-13-23-16-18-11-12-19(20(15-18)27-9-3)28-17-21(26)24-22(4,5)6;;/h11-12,15,23H,7-10,13-14,16-17H2,1-6H3,(H,24,26);2*1H |
| InChIKey | IPSPXBWDCAVVAD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|