C16H27Cl3N2 — CID 17215246
N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17215246) has the molecular formula C16H27Cl3N2 and a molecular weight of 353.76 g/mol. Its IUPAC name is N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215246 |
| Molecular Formula | C16H27Cl3N2 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCN(CC)CCCNC/C=C/c1ccc(Cl)cc1.Cl.Cl |
| InChI | InChI=1S/C16H25ClN2.2ClH/c1-3-19(4-2)14-6-13-18-12-5-7-15-8-10-16(17)11-9-15;;/h5,7-11,18H,3-4,6,12-14H2,1-2H3;2*1H/b7-5+;; |
| InChIKey | GBKMGVYBTCYJFG-WVKUUHRJSA-N |
| XLogP | 4.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|