C13H15ClFNO — CID 17217403
(2-chloro-6-fluorophenyl)-(3-methylpiperidin-1-yl)methanone (PubChem CID 17217403) has the molecular formula C13H15ClFNO and a molecular weight of 255.72 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-(3-methylpiperidin-1-yl)methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 17217403 |
| Molecular Formula | C13H15ClFNO |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C13H15ClFNO/c1-9-4-3-7-16(8-9)13(17)12-10(14)5-2-6-11(12)15/h2,5-6,9H,3-4,7-8H2,1H3 |
| InChIKey | UOIKIELIXQPQLF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |