C19H22N2O4 — CID 17219003
2-ethoxy-N-[3-(2-methoxyethylcarbamoyl)phenyl]benzamide (PubChem CID 17219003) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-ethoxy-N-[3-(2-methoxyethylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-ethoxy-N-[3-(2-methoxyethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17219003 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-ethoxy-N-[3-(2-methoxyethylcarbamoyl)phenyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1cccc(C(=O)NCCOC)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-3-25-17-10-5-4-9-16(17)19(23)21-15-8-6-7-14(13-15)18(22)20-11-12-24-2/h4-10,13H,3,11-12H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | IXTKDOLARCJTPY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|