C19H12Cl2N4O — CID 17219665
2,5-dichloro-N-(2-phenylbenzotriazol-5-yl)benzamide (PubChem CID 17219665) has the molecular formula C19H12Cl2N4O and a molecular weight of 383.24 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-phenylbenzotriazol-5-yl)benzamide.
| Compound Name | 2,5-dichloro-N-(2-phenylbenzotriazol-5-yl)benzamide |
|---|---|
| PubChem CID | 17219665 |
| Molecular Formula | C19H12Cl2N4O |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2,5-dichloro-N-(2-phenylbenzotriazol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2nn(-c3ccccc3)nc2c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H12Cl2N4O/c20-12-6-8-16(21)15(10-12)19(26)22-13-7-9-17-18(11-13)24-25(23-17)14-4-2-1-3-5-14/h1-11H,(H,22,26) |
| InChIKey | GYCJNIMROVWDHO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |