C22H17ClN4O2 — CID 17219787
(E)-3-(4-chlorophenyl)-N-[2-(4-methoxyphenyl)benzotriazol-5-yl]prop-2-enamide (PubChem CID 17219787) has the molecular formula C22H17ClN4O2 and a molecular weight of 404.86 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[2-(4-methoxyphenyl)benzotriazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[2-(4-methoxyphenyl)benzotriazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17219787 |
| Molecular Formula | C22H17ClN4O2 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[2-(4-methoxyphenyl)benzotriazol-5-yl]prop-2-enamide |
| SMILES | COc1ccc(-n2nc3ccc(NC(=O)/C=C/c4ccc(Cl)cc4)cc3n2)cc1 |
| InChI | InChI=1S/C22H17ClN4O2/c1-29-19-10-8-18(9-11-19)27-25-20-12-7-17(14-21(20)26-27)24-22(28)13-4-15-2-5-16(23)6-3-15/h2-14H,1H3,(H,24,28)/b13-4+ |
| InChIKey | MHDASCWOCLALJB-YIXHJXPBSA-N |
| XLogP | 4.73 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|