About N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride
N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride (PubChem CID 17221236) has the molecular formula C12H18ClN
and a molecular weight of 211.74 g/mol. Its IUPAC name is N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| PubChem CID | 17221236 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| SMILES | CCCNC1Cc2ccccc2C1.Cl |
| InChI | InChI=1S/C12H17N.ClH/c1-2-7-13-12-8-10-5-3-4-6-11(10)9-12;/h3-6,12-13H,2,7-9H2,1H3;1H |
| InChIKey | NLSYLGZOXAOCFC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride?
The IUPAC name of N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride (CID 17221236) is N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride.
What is the SMILES notation for N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride?
The canonical SMILES for N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride is CCCNC1Cc2ccccc2C1.Cl.
What is the InChIKey of N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride?
The InChIKey is NLSYLGZOXAOCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N.ClH/c1-2-7-13-12-8-10-5-3-4-6-11(10)9-12;/h3-6,12-13H,2,7-9H2,1H3;1H.
What are the key properties of N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride?
N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride has a molecular weight of 211.74 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-2,3-dihydro-1H-inden-2-amine;hydrochloride is sourced from PubChem (CID 17221236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).