C16H22N4O2 — CID 17221332
5-nitro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]benzonitrile (PubChem CID 17221332) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 5-nitro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]benzonitrile.
| Compound Name | 5-nitro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 17221332 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 5-nitro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]benzonitrile |
| SMILES | CC1(C)CC(Nc2ccc([N+](=O)[O-])cc2C#N)CC(C)(C)N1 |
| InChI | InChI=1S/C16H22N4O2/c1-15(2)8-12(9-16(3,4)19-15)18-14-6-5-13(20(21)22)7-11(14)10-17/h5-7,12,18-19H,8-9H2,1-4H3 |
| InChIKey | LDWXERNINWPHAB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|