C24H23ClN2O3 — CID 17221982
3-[2-(2-chlorophenoxy)propanoylamino]-N-ethyl-N-phenylbenzamide (PubChem CID 17221982) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is 3-[2-(2-chlorophenoxy)propanoylamino]-N-ethyl-N-phenylbenzamide.
| Compound Name | 3-[2-(2-chlorophenoxy)propanoylamino]-N-ethyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 17221982 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 3-[2-(2-chlorophenoxy)propanoylamino]-N-ethyl-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1cccc(NC(=O)C(C)Oc2ccccc2Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C24H23ClN2O3/c1-3-27(20-12-5-4-6-13-20)24(29)18-10-9-11-19(16-18)26-23(28)17(2)30-22-15-8-7-14-21(22)25/h4-17H,3H2,1-2H3,(H,26,28) |
| InChIKey | MBCXWXOVLANECJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |