C19H23ClN2O2 — CID 17223319
1-(2-chlorobenzoyl)-N,N-bis(prop-2-enyl)piperidine-4-carboxamide (PubChem CID 17223319) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 1-(2-chlorobenzoyl)-N,N-bis(prop-2-enyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-chlorobenzoyl)-N,N-bis(prop-2-enyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17223319 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-(2-chlorobenzoyl)-N,N-bis(prop-2-enyl)piperidine-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H23ClN2O2/c1-3-11-21(12-4-2)18(23)15-9-13-22(14-10-15)19(24)16-7-5-6-8-17(16)20/h3-8,15H,1-2,9-14H2 |
| InChIKey | OULOPXBRNTUTGS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|