C26H30ClN3O3 — CID 17223536
1-(2-chlorobenzoyl)-N-[2-(cyclohexylcarbamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 17223536) has the molecular formula C26H30ClN3O3 and a molecular weight of 468.00 g/mol. Its IUPAC name is 1-(2-chlorobenzoyl)-N-[2-(cyclohexylcarbamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-chlorobenzoyl)-N-[2-(cyclohexylcarbamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17223536 |
| Molecular Formula | C26H30ClN3O3 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 1-(2-chlorobenzoyl)-N-[2-(cyclohexylcarbamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccccc1NC(=O)C1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C26H30ClN3O3/c27-22-12-6-4-10-20(22)26(33)30-16-14-18(15-17-30)24(31)29-23-13-7-5-11-21(23)25(32)28-19-8-2-1-3-9-19/h4-7,10-13,18-19H,1-3,8-9,14-17H2,(H,28,32)(H,29,31) |
| InChIKey | VRYDVJUUOSYYDZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |