C24H34N2O3S2 — CID 17224668
N-[4-(dibutylsulfamoyl)phenyl]-2-propan-2-ylsulfanylbenzamide (PubChem CID 17224668) has the molecular formula C24H34N2O3S2 and a molecular weight of 462.68 g/mol. Its IUPAC name is N-[4-(dibutylsulfamoyl)phenyl]-2-propan-2-ylsulfanylbenzamide.
| Compound Name | N-[4-(dibutylsulfamoyl)phenyl]-2-propan-2-ylsulfanylbenzamide |
|---|---|
| PubChem CID | 17224668 |
| Molecular Formula | C24H34N2O3S2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-[4-(dibutylsulfamoyl)phenyl]-2-propan-2-ylsulfanylbenzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(NC(=O)c2ccccc2SC(C)C)cc1 |
| InChI | InChI=1S/C24H34N2O3S2/c1-5-7-17-26(18-8-6-2)31(28,29)21-15-13-20(14-16-21)25-24(27)22-11-9-10-12-23(22)30-19(3)4/h9-16,19H,5-8,17-18H2,1-4H3,(H,25,27) |
| InChIKey | UXDCNDQLIWLITC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |